C21H19NO4S2 — CID 43862357
2-[3-[(E)-[3-(3,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 43862357) has the molecular formula C21H19NO4S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-[3-[(E)-[3-(3,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | 2-[3-[(E)-[3-(3,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 43862357 |
| Molecular Formula | C21H19NO4S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2-[3-[(E)-[3-(3,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3cccc(OC(C)C(=O)O)c3)SC2=S)cc1C |
| InChI | InChI=1S/C21H19NO4S2/c1-12-7-8-16(9-13(12)2)22-19(23)18(28-21(22)27)11-15-5-4-6-17(10-15)26-14(3)20(24)25/h4-11,14H,1-3H3,(H,24,25)/b18-11+ |
| InChIKey | STFBQJWPVZEUSH-WOJGMQOQSA-N |
| XLogP | 4.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|