C21H12N2O2S2 — CID 25211645
(5E)-5-[[4-(1-benzothiophen-2-yl)quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 25211645) has the molecular formula C21H12N2O2S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is (5E)-5-[[4-(1-benzothiophen-2-yl)quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-(1-benzothiophen-2-yl)quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 25211645 |
| Molecular Formula | C21H12N2O2S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | (5E)-5-[[4-(1-benzothiophen-2-yl)quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc3nccc(-c4cc5ccccc5s4)c3c2)S1 |
| InChI | InChI=1S/C21H12N2O2S2/c24-20-19(27-21(25)23-20)10-12-5-6-16-15(9-12)14(7-8-22-16)18-11-13-3-1-2-4-17(13)26-18/h1-11H,(H,23,24,25)/b19-10+ |
| InChIKey | BQRWREILDWROJD-VXLYETTFSA-N |
| XLogP | 5.44 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|