C25H14N2O3S2 — CID 25212049
(5E)-5-[[4-[5-[2-(3-hydroxyphenyl)ethynyl]thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 25212049) has the molecular formula C25H14N2O3S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is (5E)-5-[[4-[5-[2-(3-hydroxyphenyl)ethynyl]thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[5-[2-(3-hydroxyphenyl)ethynyl]thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 25212049 |
| Molecular Formula | C25H14N2O3S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | (5E)-5-[[4-[5-[2-(3-hydroxyphenyl)ethynyl]thiophen-2-yl]quinolin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc3nccc(-c4ccc(C#Cc5cccc(O)c5)s4)c3c2)S1 |
| InChI | InChI=1S/C25H14N2O3S2/c28-17-3-1-2-15(12-17)4-6-18-7-9-22(31-18)19-10-11-26-21-8-5-16(13-20(19)21)14-23-24(29)27-25(30)32-23/h1-3,5,7-14,28H,(H,27,29,30)/b23-14+ |
| InChIKey | ZMFVAUBGEZCMJN-OEAKJJBVSA-N |
| XLogP | 5.39 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|