C31H20ClN3OS — CID 136594573
2-(2-chloro-6-phenylphenyl)imino-5-[(4-phenylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 136594573) has the molecular formula C31H20ClN3OS and a molecular weight of 518.04 g/mol. Its IUPAC name is 2-(2-chloro-6-phenylphenyl)imino-5-[(4-phenylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(2-chloro-6-phenylphenyl)imino-5-[(4-phenylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136594573 |
| Molecular Formula | C31H20ClN3OS |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | 2-(2-chloro-6-phenylphenyl)imino-5-[(4-phenylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2c(Cl)cccc2-c2ccccc2)SC1=Cc1ccc2nccc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C31H20ClN3OS/c32-26-13-7-12-24(22-10-5-2-6-11-22)29(26)34-31-35-30(36)28(37-31)19-20-14-15-27-25(18-20)23(16-17-33-27)21-8-3-1-4-9-21/h1-19H,(H,34,35,36) |
| InChIKey | QBCUEDQECGZUKL-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|