C23H19N3O2S — CID 135467081
(5Z)-5-[(4-methoxyquinolin-6-yl)methylidene]-2-[(1R,2S)-2-phenylcyclopropyl]imino-1,3-thiazolidin-4-one (PubChem CID 135467081) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is (5Z)-5-[(4-methoxyquinolin-6-yl)methylidene]-2-[(1R,2S)-2-phenylcyclopropyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-methoxyquinolin-6-yl)methylidene]-2-[(1R,2S)-2-phenylcyclopropyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135467081 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (5Z)-5-[(4-methoxyquinolin-6-yl)methylidene]-2-[(1R,2S)-2-phenylcyclopropyl]imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccnc2ccc(/C=C3\S/C(=N/[C@@H]4C[C@H]4c4ccccc4)NC3=O)cc12 |
| InChI | InChI=1S/C23H19N3O2S/c1-28-20-9-10-24-18-8-7-14(11-17(18)20)12-21-22(27)26-23(29-21)25-19-13-16(19)15-5-3-2-4-6-15/h2-12,16,19H,13H2,1H3,(H,25,26,27)/b21-12-/t16-,19+/m0/s1 |
| InChIKey | FKTRUXVDKGMROD-GXOMQTSMSA-N |
| XLogP | 4.36 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|