C16H9N3O2S2 — CID 25212143
(5E)-5-[(4-thiophen-3-ylquinazolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 25212143) has the molecular formula C16H9N3O2S2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (5E)-5-[(4-thiophen-3-ylquinazolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4-thiophen-3-ylquinazolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 25212143 |
| Molecular Formula | C16H9N3O2S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | (5E)-5-[(4-thiophen-3-ylquinazolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc3ncnc(-c4ccsc4)c3c2)S1 |
| InChI | InChI=1S/C16H9N3O2S2/c20-15-13(23-16(21)19-15)6-9-1-2-12-11(5-9)14(18-8-17-12)10-3-4-22-7-10/h1-8H,(H,19,20,21)/b13-6+ |
| InChIKey | XVVDUXLNBGZOBQ-AWNIVKPZSA-N |
| XLogP | 3.68 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|