C15H15N5OS — CID 136618851
5-[[4-(dimethylamino)quinazolin-6-yl]methylidene]-2-methylimino-1,3-thiazolidin-4-one (PubChem CID 136618851) has the molecular formula C15H15N5OS and a molecular weight of 313.39 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)quinazolin-6-yl]methylidene]-2-methylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(dimethylamino)quinazolin-6-yl]methylidene]-2-methylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136618851 |
| Molecular Formula | C15H15N5OS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 5-[[4-(dimethylamino)quinazolin-6-yl]methylidene]-2-methylimino-1,3-thiazolidin-4-one |
| SMILES | C/N=C1\NC(=O)C(=Cc2ccc3ncnc(N(C)C)c3c2)S1 |
| InChI | InChI=1S/C15H15N5OS/c1-16-15-19-14(21)12(22-15)7-9-4-5-11-10(6-9)13(20(2)3)18-8-17-11/h4-8H,1-3H3,(H,16,19,21) |
| InChIKey | LXBDFRXPQQKMHN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|