C29H31ClN6O2S — CID 86279037
(5Z)-5-[[4-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]quinazolin-6-yl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one (PubChem CID 86279037) has the molecular formula C29H31ClN6O2S and a molecular weight of 563.13 g/mol. Its IUPAC name is (5Z)-5-[[4-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]quinazolin-6-yl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[4-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]quinazolin-6-yl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 86279037 |
| Molecular Formula | C29H31ClN6O2S |
| Molecular Weight | 563.13 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | (5Z)-5-[[4-[3-chloro-4-(4-propylpiperazin-1-yl)phenyl]quinazolin-6-yl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
| SMILES | CCCN1CCN(c2ccc(-c3ncnc4ccc(/C=C5\SC(N6CCOCC6)=NC5=O)cc34)cc2Cl)CC1 |
| InChI | InChI=1S/C29H31ClN6O2S/c1-2-7-34-8-10-35(11-9-34)25-6-4-21(18-23(25)30)27-22-16-20(3-5-24(22)31-19-32-27)17-26-28(37)33-29(39-26)36-12-14-38-15-13-36/h3-6,16-19H,2,7-15H2,1H3/b26-17- |
| InChIKey | PFZIGBSXPCEOIH-ONUIUJJFSA-N |
| XLogP | 4.78 |
| TPSA | 74.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.13 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|