C30H33N5OS — CID 86279116
(5Z)-5-[[4-[4-(4-propylpiperazin-1-yl)phenyl]quinolin-6-yl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one (PubChem CID 86279116) has the molecular formula C30H33N5OS and a molecular weight of 511.70 g/mol. Its IUPAC name is (5Z)-5-[[4-[4-(4-propylpiperazin-1-yl)phenyl]quinolin-6-yl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[4-[4-(4-propylpiperazin-1-yl)phenyl]quinolin-6-yl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 86279116 |
| Molecular Formula | C30H33N5OS |
| Molecular Weight | 511.70 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | (5Z)-5-[[4-[4-(4-propylpiperazin-1-yl)phenyl]quinolin-6-yl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
| SMILES | CCCN1CCN(c2ccc(-c3ccnc4ccc(/C=C5\SC(N6CCCC6)=NC5=O)cc34)cc2)CC1 |
| InChI | InChI=1S/C30H33N5OS/c1-2-13-33-16-18-34(19-17-33)24-8-6-23(7-9-24)25-11-12-31-27-10-5-22(20-26(25)27)21-28-29(36)32-30(37-28)35-14-3-4-15-35/h5-12,20-21H,2-4,13-19H2,1H3/b28-21- |
| InChIKey | NTABILPQAGYTEJ-HFTWOUSFSA-N |
| XLogP | 5.50 |
| TPSA | 52.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.70 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|