C30H32FN5OS — CID 86279644
(5Z)-5-[[4-[3-fluoro-4-(4-propan-2-ylpiperazin-1-yl)phenyl]quinolin-6-yl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one (PubChem CID 86279644) has the molecular formula C30H32FN5OS and a molecular weight of 529.69 g/mol. Its IUPAC name is (5Z)-5-[[4-[3-fluoro-4-(4-propan-2-ylpiperazin-1-yl)phenyl]quinolin-6-yl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[4-[3-fluoro-4-(4-propan-2-ylpiperazin-1-yl)phenyl]quinolin-6-yl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 86279644 |
| Molecular Formula | C30H32FN5OS |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | (5Z)-5-[[4-[3-fluoro-4-(4-propan-2-ylpiperazin-1-yl)phenyl]quinolin-6-yl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
| SMILES | CC(C)N1CCN(c2ccc(-c3ccnc4ccc(/C=C5\SC(N6CCCC6)=NC5=O)cc34)cc2F)CC1 |
| InChI | InChI=1S/C30H32FN5OS/c1-20(2)34-13-15-35(16-14-34)27-8-6-22(19-25(27)31)23-9-10-32-26-7-5-21(17-24(23)26)18-28-29(37)33-30(38-28)36-11-3-4-12-36/h5-10,17-20H,3-4,11-16H2,1-2H3/b28-18- |
| InChIKey | SNHCTBXATBOHST-VEILYXNESA-N |
| XLogP | 5.64 |
| TPSA | 52.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|