C30H34N6O2S — CID 86278974
(5Z)-5-[[4-[3-methyl-4-(4-propan-2-ylpiperazin-1-yl)phenyl]quinazolin-6-yl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one (PubChem CID 86278974) has the molecular formula C30H34N6O2S and a molecular weight of 542.71 g/mol. Its IUPAC name is (5Z)-5-[[4-[3-methyl-4-(4-propan-2-ylpiperazin-1-yl)phenyl]quinazolin-6-yl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[4-[3-methyl-4-(4-propan-2-ylpiperazin-1-yl)phenyl]quinazolin-6-yl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 86278974 |
| Molecular Formula | C30H34N6O2S |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | (5Z)-5-[[4-[3-methyl-4-(4-propan-2-ylpiperazin-1-yl)phenyl]quinazolin-6-yl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
| SMILES | Cc1cc(-c2ncnc3ccc(/C=C4\SC(N5CCOCC5)=NC4=O)cc23)ccc1N1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C30H34N6O2S/c1-20(2)34-8-10-35(11-9-34)26-7-5-23(16-21(26)3)28-24-17-22(4-6-25(24)31-19-32-28)18-27-29(37)33-30(39-27)36-12-14-38-15-13-36/h4-7,16-20H,8-15H2,1-3H3/b27-18- |
| InChIKey | OSBZCPTUXDAHPH-IMRQLAEWSA-N |
| XLogP | 4.44 |
| TPSA | 74.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|