C12H12N2O3S — CID 6614726
5-(furan-3-ylmethylidene)-2-morpholin-4-yl-1,3-thiazol-4-one (PubChem CID 6614726) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 5-(furan-3-ylmethylidene)-2-morpholin-4-yl-1,3-thiazol-4-one.
| Compound Name | 5-(furan-3-ylmethylidene)-2-morpholin-4-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 6614726 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 5-(furan-3-ylmethylidene)-2-morpholin-4-yl-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCOCC2)SC1=Cc1ccoc1 |
| InChI | InChI=1S/C12H12N2O3S/c15-11-10(7-9-1-4-17-8-9)18-12(13-11)14-2-5-16-6-3-14/h1,4,7-8H,2-3,5-6H2 |
| InChIKey | MWXWYHXHYMMBEW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|