C14H12ClN3O4S — CID 1422423
(5E)-5-[(4-chloro-3-nitrophenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one (PubChem CID 1422423) has the molecular formula C14H12ClN3O4S and a molecular weight of 353.79 g/mol. Its IUPAC name is (5E)-5-[(4-chloro-3-nitrophenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[(4-chloro-3-nitrophenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 1422423 |
| Molecular Formula | C14H12ClN3O4S |
| Molecular Weight | 353.79 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | (5E)-5-[(4-chloro-3-nitrophenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCOCC2)S/C1=C/c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12ClN3O4S/c15-10-2-1-9(7-11(10)18(20)21)8-12-13(19)16-14(23-12)17-3-5-22-6-4-17/h1-2,7-8H,3-6H2/b12-8+ |
| InChIKey | IYQWWUOJGGFIRP-XYOKQWHBSA-N |
| XLogP | 2.55 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.79 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|