C21H17F3N4O4S — CID 6533067
2-nitro-4-[(Z)-[4-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-4-ium-1-yl]-1,3-thiazol-5-ylidene]methyl]phenolate (PubChem CID 6533067) has the molecular formula C21H17F3N4O4S and a molecular weight of 478.45 g/mol. Its IUPAC name is 2-nitro-4-[(Z)-[4-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-4-ium-1-yl]-1,3-thiazol-5-ylidene]methyl]phenolate.
| Compound Name | 2-nitro-4-[(Z)-[4-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-4-ium-1-yl]-1,3-thiazol-5-ylidene]methyl]phenolate |
|---|---|
| PubChem CID | 6533067 |
| Molecular Formula | C21H17F3N4O4S |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-nitro-4-[(Z)-[4-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-4-ium-1-yl]-1,3-thiazol-5-ylidene]methyl]phenolate |
| SMILES | O=C1N=C(N2CC[NH+](c3cccc(C(F)(F)F)c3)CC2)S/C1=C\c1ccc([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17F3N4O4S/c22-21(23,24)14-2-1-3-15(12-14)26-6-8-27(9-7-26)20-25-19(30)18(33-20)11-13-4-5-17(29)16(10-13)28(31)32/h1-5,10-12,29H,6-9H2/b18-11- |
| InChIKey | CZKWHEOWWKPMGC-WQRHYEAKSA-N |
| XLogP | 2.19 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|