C25H20F3N3O2S — CID 4613108
5-[(5-phenylfuran-2-yl)methylidene]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 4613108) has the molecular formula C25H20F3N3O2S and a molecular weight of 483.52 g/mol. Its IUPAC name is 5-[(5-phenylfuran-2-yl)methylidene]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | 5-[(5-phenylfuran-2-yl)methylidene]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 4613108 |
| Molecular Formula | C25H20F3N3O2S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 5-[(5-phenylfuran-2-yl)methylidene]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCN(c3cccc(C(F)(F)F)c3)CC2)SC1=Cc1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C25H20F3N3O2S/c26-25(27,28)18-7-4-8-19(15-18)30-11-13-31(14-12-30)24-29-23(32)22(34-24)16-20-9-10-21(33-20)17-5-2-1-3-6-17/h1-10,15-16H,11-14H2 |
| InChIKey | UNVJUCIVTUPVGI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|