C26H22F3N3O2S — CID 3394365
2-[4-(2-methylphenyl)piperazin-1-yl]-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 3394365) has the molecular formula C26H22F3N3O2S and a molecular weight of 497.54 g/mol. Its IUPAC name is 2-[4-(2-methylphenyl)piperazin-1-yl]-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-[4-(2-methylphenyl)piperazin-1-yl]-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 3394365 |
| Molecular Formula | C26H22F3N3O2S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 2-[4-(2-methylphenyl)piperazin-1-yl]-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1ccccc1N1CCN(C2=NC(=O)C(=Cc3ccc(-c4cccc(C(F)(F)F)c4)o3)S2)CC1 |
| InChI | InChI=1S/C26H22F3N3O2S/c1-17-5-2-3-8-21(17)31-11-13-32(14-12-31)25-30-24(33)23(35-25)16-20-9-10-22(34-20)18-6-4-7-19(15-18)26(27,28)29/h2-10,15-16H,11-14H2,1H3 |
| InChIKey | DLWUSWSOYNVRKM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|