C21H19F3N2O3S — CID 6581579
(5Z)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 6581579) has the molecular formula C21H19F3N2O3S and a molecular weight of 436.46 g/mol. Its IUPAC name is (5Z)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 6581579 |
| Molecular Formula | C21H19F3N2O3S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (5Z)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | C[C@H]1CN(C2=NC(=O)/C(=C/c3ccc(-c4cccc(C(F)(F)F)c4)o3)S2)C[C@H](C)O1 |
| InChI | InChI=1S/C21H19F3N2O3S/c1-12-10-26(11-13(2)28-12)20-25-19(27)18(30-20)9-16-6-7-17(29-16)14-4-3-5-15(8-14)21(22,23)24/h3-9,12-13H,10-11H2,1-2H3/b18-9-/t12-,13-/m0/s1 |
| InChIKey | UXLCMHBQTNGESC-VDYCAFGDSA-N |
| XLogP | 5.04 |
| TPSA | 55.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|