C20H19ClN2O3S — CID 7494070
(5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one (PubChem CID 7494070) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is (5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 7494070 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | (5E)-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-4-one |
| SMILES | C[C@@H]1CN(C2=NC(=O)/C(=C\c3ccc(-c4ccccc4Cl)o3)S2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H19ClN2O3S/c1-12-10-23(11-13(2)25-12)20-22-19(24)18(27-20)9-14-7-8-17(26-14)15-5-3-4-6-16(15)21/h3-9,12-13H,10-11H2,1-2H3/b18-9+/t12-,13+ |
| InChIKey | RRYSTCATLXOMHY-ZDDMZOBVSA-N |
| XLogP | 4.68 |
| TPSA | 55.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|