C25H21ClN4O4S — CID 3780920
2-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 3780920) has the molecular formula C25H21ClN4O4S and a molecular weight of 508.99 g/mol. Its IUPAC name is 2-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 3780920 |
| Molecular Formula | C25H21ClN4O4S |
| Molecular Weight | 508.99 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 2-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1ccc(N2CCN(C3=NC(=O)C(=Cc4ccc(-c5cccc([N+](=O)[O-])c5)o4)S3)CC2)cc1Cl |
| InChI | InChI=1S/C25H21ClN4O4S/c1-16-5-6-18(14-21(16)26)28-9-11-29(12-10-28)25-27-24(31)23(35-25)15-20-7-8-22(34-20)17-3-2-4-19(13-17)30(32)33/h2-8,13-15H,9-12H2,1H3 |
| InChIKey | DYGQSAPXDLGURC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 92.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.99 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|