C24H19BrClN3O2S — CID 5089490
5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-[4-(3-chlorophenyl)piperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 5089490) has the molecular formula C24H19BrClN3O2S and a molecular weight of 528.86 g/mol. Its IUPAC name is 5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-[4-(3-chlorophenyl)piperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | 5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-[4-(3-chlorophenyl)piperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 5089490 |
| Molecular Formula | C24H19BrClN3O2S |
| Molecular Weight | 528.86 g/mol |
| Exact Mass | 527.01 |
| IUPAC Name | 5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-[4-(3-chlorophenyl)piperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCN(c3cccc(Cl)c3)CC2)SC1=Cc1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C24H19BrClN3O2S/c25-17-6-4-16(5-7-17)21-9-8-20(31-21)15-22-23(30)27-24(32-22)29-12-10-28(11-13-29)19-3-1-2-18(26)14-19/h1-9,14-15H,10-13H2 |
| InChIKey | UOUHICVSVKXTJX-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.86 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|