C20H22N3O2S+ — CID 2027541
(5Z)-5-[[5-(4-methylphenyl)furan-2-yl]methylidene]-2-(4-methylpiperazin-4-ium-1-yl)-1,3-thiazol-4-one (PubChem CID 2027541) has the molecular formula C20H22N3O2S+ and a molecular weight of 368.48 g/mol. Its IUPAC name is (5Z)-5-[[5-(4-methylphenyl)furan-2-yl]methylidene]-2-(4-methylpiperazin-4-ium-1-yl)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[5-(4-methylphenyl)furan-2-yl]methylidene]-2-(4-methylpiperazin-4-ium-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2027541 |
| Molecular Formula | C20H22N3O2S+ |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (5Z)-5-[[5-(4-methylphenyl)furan-2-yl]methylidene]-2-(4-methylpiperazin-4-ium-1-yl)-1,3-thiazol-4-one |
| SMILES | Cc1ccc(-c2ccc(/C=C3\SC(N4CC[NH+](C)CC4)=NC3=O)o2)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-14-3-5-15(6-4-14)17-8-7-16(25-17)13-18-19(24)21-20(26-18)23-11-9-22(2)10-12-23/h3-8,13H,9-12H2,1-2H3/p+1/b18-13- |
| InChIKey | ZHLPRTZCIDGNBD-AQTBWJFISA-O |
| XLogP | 2.06 |
| TPSA | 50.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|