C21H21N4O2S+ — CID 7025052
3-[4-[(5E)-4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazol-2-yl]piperazin-1-ium-1-yl]propanenitrile (PubChem CID 7025052) has the molecular formula C21H21N4O2S+ and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-[4-[(5E)-4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazol-2-yl]piperazin-1-ium-1-yl]propanenitrile.
| Compound Name | 3-[4-[(5E)-4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazol-2-yl]piperazin-1-ium-1-yl]propanenitrile |
|---|---|
| PubChem CID | 7025052 |
| Molecular Formula | C21H21N4O2S+ |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-[4-[(5E)-4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-1,3-thiazol-2-yl]piperazin-1-ium-1-yl]propanenitrile |
| SMILES | N#CCC[NH+]1CCN(C2=NC(=O)/C(=C\c3ccc(-c4ccccc4)o3)S2)CC1 |
| InChI | InChI=1S/C21H20N4O2S/c22-9-4-10-24-11-13-25(14-12-24)21-23-20(26)19(28-21)15-17-7-8-18(27-17)16-5-2-1-3-6-16/h1-3,5-8,15H,4,10-14H2/p+1/b19-15+ |
| InChIKey | YTDPXIMEWMDLHJ-XDJHFCHBSA-O |
| XLogP | 2.03 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|