C17H18N4OS — CID 3135992
3-[4-(5-benzylidene-4-oxo-1,3-thiazol-2-yl)piperazin-1-yl]propanenitrile (PubChem CID 3135992) has the molecular formula C17H18N4OS and a molecular weight of 326.42 g/mol. Its IUPAC name is 3-[4-(5-benzylidene-4-oxo-1,3-thiazol-2-yl)piperazin-1-yl]propanenitrile.
| Compound Name | 3-[4-(5-benzylidene-4-oxo-1,3-thiazol-2-yl)piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 3135992 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-[4-(5-benzylidene-4-oxo-1,3-thiazol-2-yl)piperazin-1-yl]propanenitrile |
| SMILES | N#CCCN1CCN(C2=NC(=O)C(=Cc3ccccc3)S2)CC1 |
| InChI | InChI=1S/C17H18N4OS/c18-7-4-8-20-9-11-21(12-10-20)17-19-16(22)15(23-17)13-14-5-2-1-3-6-14/h1-3,5-6,13H,4,8-12H2 |
| InChIKey | JZSCMVUIJWLLTO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|