C25H29N3OS — CID 69015563
2-(4-benzylpiperazin-1-yl)-5-[(4-butylphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 69015563) has the molecular formula C25H29N3OS and a molecular weight of 419.59 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-5-[(4-butylphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-5-[(4-butylphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 69015563 |
| Molecular Formula | C25H29N3OS |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-5-[(4-butylphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | CCCCc1ccc(C=C2SC(N3CCN(Cc4ccccc4)CC3)=NC2=O)cc1 |
| InChI | InChI=1S/C25H29N3OS/c1-2-3-7-20-10-12-21(13-11-20)18-23-24(29)26-25(30-23)28-16-14-27(15-17-28)19-22-8-5-4-6-9-22/h4-6,8-13,18H,2-3,7,14-17,19H2,1H3 |
| InChIKey | CYYRTJSODHJPIZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|