C29H37N3OS — CID 69013973
2-(4-benzylpiperazin-1-yl)-5-[(4-octylphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 69013973) has the molecular formula C29H37N3OS and a molecular weight of 475.70 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-5-[(4-octylphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-5-[(4-octylphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 69013973 |
| Molecular Formula | C29H37N3OS |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-5-[(4-octylphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | CCCCCCCCc1ccc(C=C2SC(N3CCN(Cc4ccccc4)CC3)=NC2=O)cc1 |
| InChI | InChI=1S/C29H37N3OS/c1-2-3-4-5-6-8-11-24-14-16-25(17-15-24)22-27-28(33)30-29(34-27)32-20-18-31(19-21-32)23-26-12-9-7-10-13-26/h7,9-10,12-17,22H,2-6,8,11,18-21,23H2,1H3 |
| InChIKey | PBGDRAXXBKINNL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|