C21H27N4OS+ — CID 2136574
3-[4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperazin-1-ium-1-yl]propanenitrile (PubChem CID 2136574) has the molecular formula C21H27N4OS+ and a molecular weight of 383.54 g/mol. Its IUPAC name is 3-[4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperazin-1-ium-1-yl]propanenitrile.
| Compound Name | 3-[4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperazin-1-ium-1-yl]propanenitrile |
|---|---|
| PubChem CID | 2136574 |
| Molecular Formula | C21H27N4OS+ |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 3-[4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]piperazin-1-ium-1-yl]propanenitrile |
| SMILES | CC(C)(C)c1ccc(/C=C2\SC(N3CC[NH+](CCC#N)CC3)=NC2=O)cc1 |
| InChI | InChI=1S/C21H26N4OS/c1-21(2,3)17-7-5-16(6-8-17)15-18-19(26)23-20(27-18)25-13-11-24(12-14-25)10-4-9-22/h5-8,15H,4,10-14H2,1-3H3/p+1/b18-15- |
| InChIKey | CLUWXTBOKBRGGJ-SDXDJHTJSA-O |
| XLogP | 2.07 |
| TPSA | 60.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|