C17H20N3O3S+ — CID 6936824
(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(4-ethylpiperazin-4-ium-1-yl)-1,3-thiazol-4-one (PubChem CID 6936824) has the molecular formula C17H20N3O3S+ and a molecular weight of 346.43 g/mol. Its IUPAC name is (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(4-ethylpiperazin-4-ium-1-yl)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(4-ethylpiperazin-4-ium-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 6936824 |
| Molecular Formula | C17H20N3O3S+ |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(4-ethylpiperazin-4-ium-1-yl)-1,3-thiazol-4-one |
| SMILES | CC[NH+]1CCN(C2=NC(=O)/C(=C/c3ccc4c(c3)OCO4)S2)CC1 |
| InChI | InChI=1S/C17H19N3O3S/c1-2-19-5-7-20(8-6-19)17-18-16(21)15(24-17)10-12-3-4-13-14(9-12)23-11-22-13/h3-4,9-10H,2,5-8,11H2,1H3/p+1/b15-10- |
| InChIKey | OVTALRIRJWDNEG-GDNBJRDFSA-O |
| XLogP | 0.61 |
| TPSA | 55.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|