C24H26FN3OS — CID 69013031
5-[(4-tert-butylphenyl)methylidene]-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 69013031) has the molecular formula C24H26FN3OS and a molecular weight of 423.56 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)methylidene]-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | 5-[(4-tert-butylphenyl)methylidene]-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 69013031 |
| Molecular Formula | C24H26FN3OS |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 5-[(4-tert-butylphenyl)methylidene]-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | CC(C)(C)c1ccc(C=C2SC(N3CCN(c4ccccc4F)CC3)=NC2=O)cc1 |
| InChI | InChI=1S/C24H26FN3OS/c1-24(2,3)18-10-8-17(9-11-18)16-21-22(29)26-23(30-21)28-14-12-27(13-15-28)20-7-5-4-6-19(20)25/h4-11,16H,12-15H2,1-3H3 |
| InChIKey | XYHCRBWEEJGWJE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|