C24H22F3N3O2S — CID 2009369
(5Z)-5-[(2-prop-2-enoxyphenyl)methylidene]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 2009369) has the molecular formula C24H22F3N3O2S and a molecular weight of 473.52 g/mol. Its IUPAC name is (5Z)-5-[(2-prop-2-enoxyphenyl)methylidene]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[(2-prop-2-enoxyphenyl)methylidene]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2009369 |
| Molecular Formula | C24H22F3N3O2S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (5Z)-5-[(2-prop-2-enoxyphenyl)methylidene]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | C=CCOc1ccccc1/C=C1\SC(N2CCN(c3cccc(C(F)(F)F)c3)CC2)=NC1=O |
| InChI | InChI=1S/C24H22F3N3O2S/c1-2-14-32-20-9-4-3-6-17(20)15-21-22(31)28-23(33-21)30-12-10-29(11-13-30)19-8-5-7-18(16-19)24(25,26)27/h2-9,15-16H,1,10-14H2/b21-15- |
| InChIKey | JAGZJWKYHCRMMU-QNGOZBTKSA-N |
| XLogP | 5.06 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|