C15H13F3N2OS — CID 17045291
(5Z)-2-pyrrolidin-1-yl-5-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 17045291) has the molecular formula C15H13F3N2OS and a molecular weight of 326.34 g/mol. Its IUPAC name is (5Z)-2-pyrrolidin-1-yl-5-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-pyrrolidin-1-yl-5-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 17045291 |
| Molecular Formula | C15H13F3N2OS |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (5Z)-2-pyrrolidin-1-yl-5-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCCC2)S/C1=C\c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2OS/c16-15(17,18)11-6-2-1-5-10(11)9-12-13(21)19-14(22-12)20-7-3-4-8-20/h1-2,5-6,9H,3-4,7-8H2/b12-9- |
| InChIKey | XGMUCOIYERMATQ-XFXZXTDPSA-N |
| XLogP | 3.77 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|