C14H12F2N2O2S — CID 68637488
5-[(4,5-difluoro-2-hydroxyphenyl)methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one (PubChem CID 68637488) has the molecular formula C14H12F2N2O2S and a molecular weight of 310.32 g/mol. Its IUPAC name is 5-[(4,5-difluoro-2-hydroxyphenyl)methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one.
| Compound Name | 5-[(4,5-difluoro-2-hydroxyphenyl)methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 68637488 |
| Molecular Formula | C14H12F2N2O2S |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 5-[(4,5-difluoro-2-hydroxyphenyl)methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCCC2)SC1=Cc1cc(F)c(F)cc1O |
| InChI | InChI=1S/C14H12F2N2O2S/c15-9-5-8(11(19)7-10(9)16)6-12-13(20)17-14(21-12)18-3-1-2-4-18/h5-7,19H,1-4H2 |
| InChIKey | POGGLPXLJFKQHX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|