C16H18FN3O3S — CID 70951020
(5Z)-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 70951020) has the molecular formula C16H18FN3O3S and a molecular weight of 351.40 g/mol. Its IUPAC name is (5Z)-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 70951020 |
| Molecular Formula | C16H18FN3O3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (5Z)-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCN(CCO)CC2)S/C1=C\c1cc(F)ccc1O |
| InChI | InChI=1S/C16H18FN3O3S/c17-12-1-2-13(22)11(9-12)10-14-15(23)18-16(24-14)20-5-3-19(4-6-20)7-8-21/h1-2,9-10,21-22H,3-8H2/b14-10- |
| InChIKey | UQAFTVLXOIOPPY-UVTDQMKNSA-N |
| XLogP | 1.11 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|