C15H16BrN3O2S — CID 71961761
5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one (PubChem CID 71961761) has the molecular formula C15H16BrN3O2S and a molecular weight of 382.28 g/mol. Its IUPAC name is 5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 71961761 |
| Molecular Formula | C15H16BrN3O2S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one |
| SMILES | CN1CCN(C2=NC(=O)C(=Cc3cc(Br)ccc3O)S2)CC1 |
| InChI | InChI=1S/C15H16BrN3O2S/c1-18-4-6-19(7-5-18)15-17-14(21)13(22-15)9-10-8-11(16)2-3-12(10)20/h2-3,8-9,20H,4-7H2,1H3 |
| InChIKey | MRVHXAKCDVGREZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|