C25H23F4N5O2S — CID 58311853
(5Z)-5-[[1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 58311853) has the molecular formula C25H23F4N5O2S and a molecular weight of 533.55 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58311853 |
| Molecular Formula | C25H23F4N5O2S |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | (5Z)-5-[[1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCN(CCO)CC2)S/C1=C\c1ccc2c(cnn2Cc2ccc(F)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C25H23F4N5O2S/c26-19-3-2-17(20(13-19)25(27,28)29)15-34-21-4-1-16(11-18(21)14-30-34)12-22-23(36)31-24(37-22)33-7-5-32(6-8-33)9-10-35/h1-4,11-14,35H,5-10,15H2/b22-12- |
| InChIKey | CILMLMSTWKFKOV-UUYOSTAYSA-N |
| XLogP | 3.82 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|