C26H23F6N5O2S — CID 86654600
5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3R)-3-(hydroxymethyl)-4-methylpiperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 86654600) has the molecular formula C26H23F6N5O2S and a molecular weight of 583.56 g/mol. Its IUPAC name is 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3R)-3-(hydroxymethyl)-4-methylpiperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3R)-3-(hydroxymethyl)-4-methylpiperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 86654600 |
| Molecular Formula | C26H23F6N5O2S |
| Molecular Weight | 583.56 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3R)-3-(hydroxymethyl)-4-methylpiperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | CN1CCN(C2=NC(=O)C(=Cc3ccc4c(cnn4Cc4ccc(C(F)(F)F)cc4C(F)(F)F)c3)S2)C[C@@H]1CO |
| InChI | InChI=1S/C26H23F6N5O2S/c1-35-6-7-36(13-19(35)14-38)24-34-23(39)22(40-24)9-15-2-5-21-17(8-15)11-33-37(21)12-16-3-4-18(25(27,28)29)10-20(16)26(30,31)32/h2-5,8-11,19,38H,6-7,12-14H2,1H3/t19-/m1/s1 |
| InChIKey | FDAAEFNZSZVXQK-LJQANCHMSA-N |
| XLogP | 4.70 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|