C25H21F6N5OS — CID 86654565
5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(1,4-diazepan-1-yl)-1,3-thiazol-4-one (PubChem CID 86654565) has the molecular formula C25H21F6N5OS and a molecular weight of 553.53 g/mol. Its IUPAC name is 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(1,4-diazepan-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(1,4-diazepan-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 86654565 |
| Molecular Formula | C25H21F6N5OS |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(1,4-diazepan-1-yl)-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCCNCC2)SC1=Cc1ccc2c(cnn2Cc2ccc(C(F)(F)F)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C25H21F6N5OS/c26-24(27,28)18-4-3-16(19(12-18)25(29,30)31)14-36-20-5-2-15(10-17(20)13-33-36)11-21-22(37)34-23(38-21)35-8-1-6-32-7-9-35/h2-5,10-13,32H,1,6-9,14H2 |
| InChIKey | JDHBLEGOKDOKAL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|