C26H26F3N5OS — CID 58311765
(5Z)-2-(4-methyl-1,4-diazepan-1-yl)-5-[[1-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 58311765) has the molecular formula C26H26F3N5OS and a molecular weight of 513.59 g/mol. Its IUPAC name is (5Z)-2-(4-methyl-1,4-diazepan-1-yl)-5-[[1-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-(4-methyl-1,4-diazepan-1-yl)-5-[[1-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58311765 |
| Molecular Formula | C26H26F3N5OS |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | (5Z)-2-(4-methyl-1,4-diazepan-1-yl)-5-[[1-[[4-methyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1ccc(Cn2ncc3cc(/C=C4\SC(N5CCCN(C)CC5)=NC4=O)ccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H26F3N5OS/c1-17-4-6-19(21(12-17)26(27,28)29)16-34-22-7-5-18(13-20(22)15-30-34)14-23-24(35)31-25(36-23)33-9-3-8-32(2)10-11-33/h4-7,12-15H,3,8-11,16H2,1-2H3/b23-14- |
| InChIKey | NDSRGWSGBIILLI-UCQKPKSFSA-N |
| XLogP | 5.02 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|