C25H21F3N6OS — CID 67240386
4-[[5-[(E)-[2-(4-methylpiperazin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]indazol-1-yl]methyl]-3-(trifluoromethyl)benzonitrile (PubChem CID 67240386) has the molecular formula C25H21F3N6OS and a molecular weight of 510.55 g/mol. Its IUPAC name is 4-[[5-[(E)-[2-(4-methylpiperazin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]indazol-1-yl]methyl]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[5-[(E)-[2-(4-methylpiperazin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]indazol-1-yl]methyl]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 67240386 |
| Molecular Formula | C25H21F3N6OS |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 4-[[5-[(E)-[2-(4-methylpiperazin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]indazol-1-yl]methyl]-3-(trifluoromethyl)benzonitrile |
| SMILES | CN1CCN(C2=NC(=O)/C(=C\c3ccc4c(cnn4Cc4ccc(C#N)cc4C(F)(F)F)c3)S2)CC1 |
| InChI | InChI=1S/C25H21F3N6OS/c1-32-6-8-33(9-7-32)24-31-23(35)22(36-24)12-16-3-5-21-19(10-16)14-30-34(21)15-18-4-2-17(13-29)11-20(18)25(26,27)28/h2-5,10-12,14H,6-9,15H2,1H3/b22-12+ |
| InChIKey | VAGQYTZXHLCRGD-WSDLNYQXSA-N |
| XLogP | 4.19 |
| TPSA | 77.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|