C23H20ClF3N4O3S2 — CID 67240519
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1,3-thiazol-4-one (PubChem CID 67240519) has the molecular formula C23H20ClF3N4O3S2 and a molecular weight of 557.02 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 67240519 |
| Molecular Formula | C23H20ClF3N4O3S2 |
| Molecular Weight | 557.02 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(1,1-dihydroxy-1,4-thiazinan-4-yl)-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCS(O)(O)CC2)SC1=Cc1ccc2c(cnn2Cc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20ClF3N4O3S2/c24-17-3-2-15(18(11-17)23(25,26)27)13-31-19-4-1-14(9-16(19)12-28-31)10-20-21(32)29-22(35-20)30-5-7-36(33,34)8-6-30/h1-4,9-12,33-34H,5-8,13H2 |
| InChIKey | ACKSOUIKYYNSOI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.02 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|