C22H16ClF3N4O2S — CID 67240345
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(3-hydroxyazetidin-1-yl)-1,3-thiazol-4-one (PubChem CID 67240345) has the molecular formula C22H16ClF3N4O2S and a molecular weight of 492.91 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(3-hydroxyazetidin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(3-hydroxyazetidin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 67240345 |
| Molecular Formula | C22H16ClF3N4O2S |
| Molecular Weight | 492.91 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(3-hydroxyazetidin-1-yl)-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CC(O)C2)SC1=Cc1ccc2c(cnn2Cc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16ClF3N4O2S/c23-15-3-2-13(17(7-15)22(24,25)26)9-30-18-4-1-12(5-14(18)8-27-30)6-19-20(32)28-21(33-19)29-10-16(31)11-29/h1-8,16,31H,9-11H2 |
| InChIKey | NTYNYBVAAQULMP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.91 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|