C22H15ClF4N4OS — CID 67241169
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(3-fluoroazetidin-1-yl)-1,3-thiazol-4-one (PubChem CID 67241169) has the molecular formula C22H15ClF4N4OS and a molecular weight of 494.90 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(3-fluoroazetidin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(3-fluoroazetidin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 67241169 |
| Molecular Formula | C22H15ClF4N4OS |
| Molecular Weight | 494.90 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(3-fluoroazetidin-1-yl)-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CC(F)C2)SC1=Cc1ccc2c(cnn2Cc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C22H15ClF4N4OS/c23-15-3-2-13(17(7-15)22(25,26)27)9-31-18-4-1-12(5-14(18)8-28-31)6-19-20(32)29-21(33-19)30-10-16(24)11-30/h1-8,16H,9-11H2 |
| InChIKey | GTBFVQUJJVYILW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.90 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|