C25H22ClF3N4O2S — CID 67241377
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-methoxypiperidin-1-yl)-1,3-thiazol-4-one (PubChem CID 67241377) has the molecular formula C25H22ClF3N4O2S and a molecular weight of 534.99 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-methoxypiperidin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-methoxypiperidin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 67241377 |
| Molecular Formula | C25H22ClF3N4O2S |
| Molecular Weight | 534.99 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-methoxypiperidin-1-yl)-1,3-thiazol-4-one |
| SMILES | COC1CCN(C2=NC(=O)C(=Cc3ccc4c(cnn4Cc4ccc(Cl)cc4C(F)(F)F)c3)S2)CC1 |
| InChI | InChI=1S/C25H22ClF3N4O2S/c1-35-19-6-8-32(9-7-19)24-31-23(34)22(36-24)11-15-2-5-21-17(10-15)13-30-33(21)14-16-3-4-18(26)12-20(16)25(27,28)29/h2-5,10-13,19H,6-9,14H2,1H3 |
| InChIKey | DMLMHEZZPHJJGL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.99 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|