C22H16ClF3N4OS — CID 67248554
2-(azetidin-1-yl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 67248554) has the molecular formula C22H16ClF3N4OS and a molecular weight of 476.91 g/mol. Its IUPAC name is 2-(azetidin-1-yl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-(azetidin-1-yl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 67248554 |
| Molecular Formula | C22H16ClF3N4OS |
| Molecular Weight | 476.91 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 2-(azetidin-1-yl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCC2)SC1=Cc1ccc2c(cnn2Cc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16ClF3N4OS/c23-16-4-3-14(17(10-16)22(24,25)26)12-30-18-5-2-13(8-15(18)11-27-30)9-19-20(31)28-21(32-19)29-6-1-7-29/h2-5,8-11H,1,6-7,12H2 |
| InChIKey | ZCIUEQHKQZUNEM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.91 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|