C26H22ClF3N6O2S — CID 58311762
(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-oxo-1,3,8-triazaspiro[4.5]decan-8-yl)-1,3-thiazol-4-one (PubChem CID 58311762) has the molecular formula C26H22ClF3N6O2S and a molecular weight of 575.02 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-oxo-1,3,8-triazaspiro[4.5]decan-8-yl)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-oxo-1,3,8-triazaspiro[4.5]decan-8-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58311762 |
| Molecular Formula | C26H22ClF3N6O2S |
| Molecular Weight | 575.02 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-oxo-1,3,8-triazaspiro[4.5]decan-8-yl)-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCC3(CC2)NCNC3=O)S/C1=C\c1ccc2c(cnn2Cc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C26H22ClF3N6O2S/c27-18-3-2-16(19(11-18)26(28,29)30)13-36-20-4-1-15(9-17(20)12-33-36)10-21-22(37)34-24(39-21)35-7-5-25(6-8-35)23(38)31-14-32-25/h1-4,9-12,32H,5-8,13-14H2,(H,31,38)/b21-10- |
| InChIKey | OXWRHQPONWYKOU-FBHDLOMBSA-N |
| XLogP | 4.24 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.02 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|