C24H21ClF3N5OS — CID 67241277
(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(2-methylpiperazin-1-yl)-1,3-thiazol-4-one (PubChem CID 67241277) has the molecular formula C24H21ClF3N5OS and a molecular weight of 519.98 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(2-methylpiperazin-1-yl)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(2-methylpiperazin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 67241277 |
| Molecular Formula | C24H21ClF3N5OS |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(2-methylpiperazin-1-yl)-1,3-thiazol-4-one |
| SMILES | CC1CNCCN1C1=NC(=O)/C(=C/c2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C24H21ClF3N5OS/c1-14-11-29-6-7-32(14)23-31-22(34)21(35-23)9-15-2-5-20-17(8-15)12-30-33(20)13-16-3-4-18(25)10-19(16)24(26,27)28/h2-5,8-10,12,14,29H,6-7,11,13H2,1H3/b21-9- |
| InChIKey | RRYRLURXEIDUID-NKVSQWTQSA-N |
| XLogP | 5.02 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|