C27H22ClF3N6OS — CID 67240868
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-pyrazol-1-ylpiperidin-1-yl)-1,3-thiazol-4-one (PubChem CID 67240868) has the molecular formula C27H22ClF3N6OS and a molecular weight of 571.03 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-pyrazol-1-ylpiperidin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-pyrazol-1-ylpiperidin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 67240868 |
| Molecular Formula | C27H22ClF3N6OS |
| Molecular Weight | 571.03 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-pyrazol-1-ylpiperidin-1-yl)-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCC(n3cccn3)CC2)SC1=Cc1ccc2c(cnn2Cc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C27H22ClF3N6OS/c28-20-4-3-18(22(14-20)27(29,30)31)16-37-23-5-2-17(12-19(23)15-33-37)13-24-25(38)34-26(39-24)35-10-6-21(7-11-35)36-9-1-8-32-36/h1-5,8-9,12-15,21H,6-7,10-11,16H2 |
| InChIKey | ZMTAJHHFKIZUKJ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.03 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|