C24H20ClF3N4O2S — CID 76756399
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-hydroxypiperidin-1-yl)-1,3-thiazol-4-one (PubChem CID 76756399) has the molecular formula C24H20ClF3N4O2S and a molecular weight of 520.96 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-hydroxypiperidin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-hydroxypiperidin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 76756399 |
| Molecular Formula | C24H20ClF3N4O2S |
| Molecular Weight | 520.96 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-hydroxypiperidin-1-yl)-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCC(O)CC2)SC1=Cc1ccc2c(cnn2Cc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20ClF3N4O2S/c25-17-3-2-15(19(11-17)24(26,27)28)13-32-20-4-1-14(9-16(20)12-29-32)10-21-22(34)30-23(35-21)31-7-5-18(33)6-8-31/h1-4,9-12,18,33H,5-8,13H2 |
| InChIKey | YWYBOBAVAIHNRE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.96 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|