C26H21F6N5O2S — CID 76756347
1-[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 76756347) has the molecular formula C26H21F6N5O2S and a molecular weight of 581.54 g/mol. Its IUPAC name is 1-[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 76756347 |
| Molecular Formula | C26H21F6N5O2S |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | 1-[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C2=NC(=O)C(=Cc3ccc4c(cnn4Cc4ccc(C(F)(F)F)cc4C(F)(F)F)c3)S2)CC1 |
| InChI | InChI=1S/C26H21F6N5O2S/c27-25(28,29)18-3-2-16(19(11-18)26(30,31)32)13-37-20-4-1-14(9-17(20)12-34-37)10-21-23(39)35-24(40-21)36-7-5-15(6-8-36)22(33)38/h1-4,9-12,15H,5-8,13H2,(H2,33,38) |
| InChIKey | NOBPODHUTNPNMA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|