C27H25F6N5OS — CID 58311781
(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 58311781) has the molecular formula C27H25F6N5OS and a molecular weight of 581.59 g/mol. Its IUPAC name is (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58311781 |
| Molecular Formula | C27H25F6N5OS |
| Molecular Weight | 581.59 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | C[C@@H]1CN(C2=NC(=O)/C(=C/c3ccc4c(cnn4Cc4ccc(C(F)(F)F)cc4C(F)(F)F)c3)S2)C[C@H](C)N1C |
| InChI | InChI=1S/C27H25F6N5OS/c1-15-12-37(13-16(2)36(15)3)25-35-24(39)23(40-25)9-17-4-7-22-19(8-17)11-34-38(22)14-18-5-6-20(26(28,29)30)10-21(18)27(31,32)33/h4-11,15-16H,12-14H2,1-3H3/b23-9-/t15-,16+ |
| InChIKey | QPRITEHCTKWNCX-XTAKAOOOSA-N |
| XLogP | 6.12 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|