C28H25F6N5O3S — CID 123769108
5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(3-hydroxy-4-morpholin-4-ylpyrrolidin-1-yl)-1,3-thiazol-4-one (PubChem CID 123769108) has the molecular formula C28H25F6N5O3S and a molecular weight of 625.60 g/mol. Its IUPAC name is 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(3-hydroxy-4-morpholin-4-ylpyrrolidin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(3-hydroxy-4-morpholin-4-ylpyrrolidin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 123769108 |
| Molecular Formula | C28H25F6N5O3S |
| Molecular Weight | 625.60 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(3-hydroxy-4-morpholin-4-ylpyrrolidin-1-yl)-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CC(O)C(N3CCOCC3)C2)SC1=Cc1ccc2c(cnn2Cc2ccc(C(F)(F)F)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C28H25F6N5O3S/c29-27(30,31)19-3-2-17(20(11-19)28(32,33)34)13-39-21-4-1-16(9-18(21)12-35-39)10-24-25(41)36-26(43-24)38-14-22(23(40)15-38)37-5-7-42-8-6-37/h1-4,9-12,22-23,40H,5-8,13-15H2 |
| InChIKey | BKBAJHAIGMPXFF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|